C34H52O7 — CID 160990114
methyl acetate;1-O-methyl 5-O-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 4-ethyl-2-methylpentanedioate;4-oxatetracyclo[6.2.1.02,7.03,5]undecane (PubChem CID 160990114) has the molecular formula C34H52O7 and a molecular weight of 572.78 g/mol. Its IUPAC name is methyl acetate;1-O-methyl 5-O-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 4-ethyl-2-methylpentanedioate;4-oxatetracyclo[6.2.1.02,7.03,5]undecane.
| Compound Name | methyl acetate;1-O-methyl 5-O-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 4-ethyl-2-methylpentanedioate;4-oxatetracyclo[6.2.1.02,7.03,5]undecane |
|---|---|
| PubChem CID | 160990114 |
| Molecular Formula | C34H52O7 |
| Molecular Weight | 572.78 g/mol |
| Exact Mass | 572.37 |
| IUPAC Name | methyl acetate;1-O-methyl 5-O-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 4-ethyl-2-methylpentanedioate;4-oxatetracyclo[6.2.1.02,7.03,5]undecane |
| SMILES | C1CC2CC1C1CC3OC3C21.CCC(CC(C)C(=O)OC)C(=O)OC1CC2CC1C1C3CCC(C3)C21.COC(C)=O |
| InChI | InChI=1S/C21H32O4.C10H14O.C3H6O2/c1-4-12(7-11(2)20(22)24-3)21(23)25-17-10-15-9-16(17)19-14-6-5-13(8-14)18(15)19;1-2-6-3-5(1)7-4-8-10(11-8)9(6)7;1-3(4)5-2/h11-19H,4-10H2,1-3H3;5-10H,1-4H2;1-2H3 |
| InChIKey | TUMVQDADMOFIOD-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.78 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|