C18H16ClN5O2 — CID 160990161
14-chloro-17-[2-(dimethylamino)ethoxyimino]-2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11(16),12,14-heptaen-9-one (PubChem CID 160990161) has the molecular formula C18H16ClN5O2 and a molecular weight of 369.81 g/mol. Its IUPAC name is 14-chloro-17-[2-(dimethylamino)ethoxyimino]-2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11(16),12,14-heptaen-9-one.
| Compound Name | 14-chloro-17-[2-(dimethylamino)ethoxyimino]-2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11(16),12,14-heptaen-9-one |
|---|---|
| PubChem CID | 160990161 |
| Molecular Formula | C18H16ClN5O2 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 14-chloro-17-[2-(dimethylamino)ethoxyimino]-2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11(16),12,14-heptaen-9-one |
| SMILES | CN(C)CCON=C1c2cc(Cl)ccc2-n2c1nc1ncccc1c2=O |
| InChI | InChI=1S/C18H16ClN5O2/c1-23(2)8-9-26-22-15-13-10-11(19)5-6-14(13)24-17(15)21-16-12(18(24)25)4-3-7-20-16/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | TUNABQLVZUMWQY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|