C24H23Cl3F3N3O5S — CID 160992764
N,N-dimethyl-4-[2-[2-methyl-4-[(5S)-5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-2-oxoethyl]-1,2-oxazolidine-2-sulfonamide (PubChem CID 160992764) has the molecular formula C24H23Cl3F3N3O5S and a molecular weight of 628.88 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-[2-methyl-4-[(5S)-5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-2-oxoethyl]-1,2-oxazolidine-2-sulfonamide.
| Compound Name | N,N-dimethyl-4-[2-[2-methyl-4-[(5S)-5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-2-oxoethyl]-1,2-oxazolidine-2-sulfonamide |
|---|---|
| PubChem CID | 160992764 |
| Molecular Formula | C24H23Cl3F3N3O5S |
| Molecular Weight | 628.88 g/mol |
| Exact Mass | 627.04 |
| IUPAC Name | N,N-dimethyl-4-[2-[2-methyl-4-[(5S)-5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-2-oxoethyl]-1,2-oxazolidine-2-sulfonamide |
| SMILES | Cc1cc(C2=NO[C@@](c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)ccc1C(=O)CC1CON(S(=O)(=O)N(C)C)C1 |
| InChI | InChI=1S/C24H23Cl3F3N3O5S/c1-13-6-15(4-5-17(13)21(34)7-14-11-33(37-12-14)39(35,36)32(2)3)20-10-23(38-31-20,24(28,29)30)16-8-18(25)22(27)19(26)9-16/h4-6,8-9,14H,7,10-12H2,1-3H3/t14?,23-/m0/s1 |
| InChIKey | TUVXTDQWRRWRAP-AQJFCTLQSA-N |
| XLogP | 5.78 |
| TPSA | 88.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.88 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|