C21H29NO3 — CID 160992825
(3R)-3-cyclopropyl-5-(4-cyclopropyl-3-propan-2-yloxyphenyl)-3-methyl-5-oxopentanamide (PubChem CID 160992825) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is (3R)-3-cyclopropyl-5-(4-cyclopropyl-3-propan-2-yloxyphenyl)-3-methyl-5-oxopentanamide.
| Compound Name | (3R)-3-cyclopropyl-5-(4-cyclopropyl-3-propan-2-yloxyphenyl)-3-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 160992825 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | (3R)-3-cyclopropyl-5-(4-cyclopropyl-3-propan-2-yloxyphenyl)-3-methyl-5-oxopentanamide |
| SMILES | CC(C)Oc1cc(C(=O)C[C@](C)(CC(N)=O)C2CC2)ccc1C1CC1 |
| InChI | InChI=1S/C21H29NO3/c1-13(2)25-19-10-15(6-9-17(19)14-4-5-14)18(23)11-21(3,12-20(22)24)16-7-8-16/h6,9-10,13-14,16H,4-5,7-8,11-12H2,1-3H3,(H2,22,24)/t21-/m1/s1 |
| InChIKey | TUWCKTYZECFZRH-OAQYLSRUSA-N |
| XLogP | 4.22 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |