About 1-morpholin-4-ylethanone;prop-1-ene
1-morpholin-4-ylethanone;prop-1-ene (PubChem CID 160992965) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is 1-morpholin-4-ylethanone;prop-1-ene.
Molecular Properties
| Compound Name | 1-morpholin-4-ylethanone;prop-1-ene |
| PubChem CID | 160992965 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 1-morpholin-4-ylethanone;prop-1-ene |
| SMILES | C=CC.CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C6H11NO2.C3H6/c1-6(8)7-2-4-9-5-3-7;1-3-2/h2-5H2,1H3;3H,1H2,2H3 |
| InChIKey | TUWPGSUNWVNCDQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-morpholin-4-ylethanone;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-4-ylethanone;prop-1-ene?
The IUPAC name of 1-morpholin-4-ylethanone;prop-1-ene (CID 160992965) is 1-morpholin-4-ylethanone;prop-1-ene.
What is the SMILES notation for 1-morpholin-4-ylethanone;prop-1-ene?
The canonical SMILES for 1-morpholin-4-ylethanone;prop-1-ene is C=CC.CC(=O)N1CCOCC1.
What is the InChIKey of 1-morpholin-4-ylethanone;prop-1-ene?
The InChIKey is TUWPGSUNWVNCDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.C3H6/c1-6(8)7-2-4-9-5-3-7;1-3-2/h2-5H2,1H3;3H,1H2,2H3.
What are the key properties of 1-morpholin-4-ylethanone;prop-1-ene?
1-morpholin-4-ylethanone;prop-1-ene has a molecular weight of 171.24 g/mol, XLogP of 1.06, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-4-ylethanone;prop-1-ene is sourced from PubChem (CID 160992965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).