About 6,8-difluorospiro[3H-chromene-2,3'-azetidine]-4-one
6,8-difluorospiro[3H-chromene-2,3'-azetidine]-4-one (PubChem CID 160993637) has the molecular formula C11H9F2NO2
and a molecular weight of 225.19 g/mol. Its IUPAC name is 6,8-difluorospiro[3H-chromene-2,3'-azetidine]-4-one.
Molecular Properties
| Compound Name | 6,8-difluorospiro[3H-chromene-2,3'-azetidine]-4-one |
| PubChem CID | 160993637 |
| Molecular Formula | C11H9F2NO2 |
| Molecular Weight | 225.19 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 6,8-difluorospiro[3H-chromene-2,3'-azetidine]-4-one |
| SMILES | O=C1CC2(CNC2)Oc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C11H9F2NO2/c12-6-1-7-9(15)3-11(4-14-5-11)16-10(7)8(13)2-6/h1-2,14H,3-5H2 |
| InChIKey | TUYLRAUSDFVQBC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.19 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,8-difluorospiro[3H-chromene-2,3'-azetidine]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-difluorospiro[3H-chromene-2,3'-azetidine]-4-one?
The IUPAC name of 6,8-difluorospiro[3H-chromene-2,3'-azetidine]-4-one (CID 160993637) is 6,8-difluorospiro[3H-chromene-2,3'-azetidine]-4-one.
What is the SMILES notation for 6,8-difluorospiro[3H-chromene-2,3'-azetidine]-4-one?
The canonical SMILES for 6,8-difluorospiro[3H-chromene-2,3'-azetidine]-4-one is O=C1CC2(CNC2)Oc2c(F)cc(F)cc21.
What is the InChIKey of 6,8-difluorospiro[3H-chromene-2,3'-azetidine]-4-one?
The InChIKey is TUYLRAUSDFVQBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F2NO2/c12-6-1-7-9(15)3-11(4-14-5-11)16-10(7)8(13)2-6/h1-2,14H,3-5H2.
What are the key properties of 6,8-difluorospiro[3H-chromene-2,3'-azetidine]-4-one?
6,8-difluorospiro[3H-chromene-2,3'-azetidine]-4-one has a molecular weight of 225.19 g/mol, XLogP of 1.27, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-difluorospiro[3H-chromene-2,3'-azetidine]-4-one is sourced from PubChem (CID 160993637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).