About 4-(7-chloro-1-benzothiophen-3-yl)-1,4-dihydroquinazoline;hydrochloride
4-(7-chloro-1-benzothiophen-3-yl)-1,4-dihydroquinazoline;hydrochloride (PubChem CID 160993664) has the molecular formula C16H12Cl2N2S
and a molecular weight of 335.26 g/mol. Its IUPAC name is 4-(7-chloro-1-benzothiophen-3-yl)-1,4-dihydroquinazoline;hydrochloride.
Molecular Properties
| Compound Name | 4-(7-chloro-1-benzothiophen-3-yl)-1,4-dihydroquinazoline;hydrochloride |
| PubChem CID | 160993664 |
| Molecular Formula | C16H12Cl2N2S |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 4-(7-chloro-1-benzothiophen-3-yl)-1,4-dihydroquinazoline;hydrochloride |
| SMILES | Cl.Clc1cccc2c(C3N=CNc4ccccc43)csc12 |
| InChI | InChI=1S/C16H11ClN2S.ClH/c17-13-6-3-5-10-12(8-20-16(10)13)15-11-4-1-2-7-14(11)18-9-19-15;/h1-9,15H,(H,18,19);1H |
| InChIKey | NUPAWTSSFJXLCN-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(7-chloro-1-benzothiophen-3-yl)-1,4-dihydroquinazoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7-chloro-1-benzothiophen-3-yl)-1,4-dihydroquinazoline;hydrochloride?
The IUPAC name of 4-(7-chloro-1-benzothiophen-3-yl)-1,4-dihydroquinazoline;hydrochloride (CID 160993664) is 4-(7-chloro-1-benzothiophen-3-yl)-1,4-dihydroquinazoline;hydrochloride.
What is the SMILES notation for 4-(7-chloro-1-benzothiophen-3-yl)-1,4-dihydroquinazoline;hydrochloride?
The canonical SMILES for 4-(7-chloro-1-benzothiophen-3-yl)-1,4-dihydroquinazoline;hydrochloride is Cl.Clc1cccc2c(C3N=CNc4ccccc43)csc12.
What is the InChIKey of 4-(7-chloro-1-benzothiophen-3-yl)-1,4-dihydroquinazoline;hydrochloride?
The InChIKey is NUPAWTSSFJXLCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClN2S.ClH/c17-13-6-3-5-10-12(8-20-16(10)13)15-11-4-1-2-7-14(11)18-9-19-15;/h1-9,15H,(H,18,19);1H.
What are the key properties of 4-(7-chloro-1-benzothiophen-3-yl)-1,4-dihydroquinazoline;hydrochloride?
4-(7-chloro-1-benzothiophen-3-yl)-1,4-dihydroquinazoline;hydrochloride has a molecular weight of 335.26 g/mol, XLogP of 5.52, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-chloro-1-benzothiophen-3-yl)-1,4-dihydroquinazoline;hydrochloride is sourced from PubChem (CID 160993664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).