C15H29F3N2O6 — CID 160995922
6-aminohexanoic acid;methanol;6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid (PubChem CID 160995922) has the molecular formula C15H29F3N2O6 and a molecular weight of 390.40 g/mol. Its IUPAC name is 6-aminohexanoic acid;methanol;6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid.
| Compound Name | 6-aminohexanoic acid;methanol;6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 160995922 |
| Molecular Formula | C15H29F3N2O6 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 6-aminohexanoic acid;methanol;6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
| SMILES | CO.NCCCCCC(=O)O.O=C(O)CCCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO3.C6H13NO2.CH4O/c9-8(10,11)7(15)12-5-3-1-2-4-6(13)14;7-5-3-1-2-4-6(8)9;1-2/h1-5H2,(H,12,15)(H,13,14);1-5,7H2,(H,8,9);2H,1H3 |
| InChIKey | TVFYJNHVFBXOKZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|