C24H34FNO2Si — CID 160995933
2-[(4S,4aS,7aS)-4-(2-fluorophenyl)-2-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-4-yl]ethynyl-tri(propan-2-yl)silane (PubChem CID 160995933) has the molecular formula C24H34FNO2Si and a molecular weight of 415.63 g/mol. Its IUPAC name is 2-[(4S,4aS,7aS)-4-(2-fluorophenyl)-2-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-4-yl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[(4S,4aS,7aS)-4-(2-fluorophenyl)-2-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-4-yl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 160995933 |
| Molecular Formula | C24H34FNO2Si |
| Molecular Weight | 415.63 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 2-[(4S,4aS,7aS)-4-(2-fluorophenyl)-2-methyl-4a,5,7,7a-tetrahydrofuro[3,4-e][1,3]oxazin-4-yl]ethynyl-tri(propan-2-yl)silane |
| SMILES | CC1=N[C@](C#C[Si](C(C)C)(C(C)C)C(C)C)(c2ccccc2F)[C@H]2COC[C@H]2O1 |
| InChI | InChI=1S/C24H34FNO2Si/c1-16(2)29(17(3)4,18(5)6)13-12-24(20-10-8-9-11-22(20)25)21-14-27-15-23(21)28-19(7)26-24/h8-11,16-18,21,23H,14-15H2,1-7H3/t21-,23+,24+/m0/s1 |
| InChIKey | HFBZLVJLKPRZIS-QPTUXGOLSA-N |
| XLogP | 5.71 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|