C17H30N6O6 — CID 160999041
1,4-dimethylpiperazine-2,5-dione;3,6-dimethylpiperazine-2,5-dione;methane;piperazine-2,5-dione (PubChem CID 160999041) has the molecular formula C17H30N6O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is 1,4-dimethylpiperazine-2,5-dione;3,6-dimethylpiperazine-2,5-dione;methane;piperazine-2,5-dione.
| Compound Name | 1,4-dimethylpiperazine-2,5-dione;3,6-dimethylpiperazine-2,5-dione;methane;piperazine-2,5-dione |
|---|---|
| PubChem CID | 160999041 |
| Molecular Formula | C17H30N6O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 1,4-dimethylpiperazine-2,5-dione;3,6-dimethylpiperazine-2,5-dione;methane;piperazine-2,5-dione |
| SMILES | C.CC1NC(=O)C(C)NC1=O.CN1CC(=O)N(C)CC1=O.O=C1CNC(=O)CN1 |
| InChI | InChI=1S/2C6H10N2O2.C4H6N2O2.CH4/c1-7-3-6(10)8(2)4-5(7)9;1-3-5(9)8-4(2)6(10)7-3;7-3-1-5-4(8)2-6-3;/h3-4H2,1-2H3;3-4H,1-2H3,(H,7,10)(H,8,9);1-2H2,(H,5,8)(H,6,7);1H4 |
| InChIKey | TVPUKGHREYLBHS-UHFFFAOYSA-N |
| XLogP | -3.21 |
| TPSA | 157.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |