C17H16N2O — CID 161001235
3-ethynylpyridine;2-methyl-4-pyridin-3-ylbut-3-yn-2-ol (PubChem CID 161001235) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is 3-ethynylpyridine;2-methyl-4-pyridin-3-ylbut-3-yn-2-ol.
| Compound Name | 3-ethynylpyridine;2-methyl-4-pyridin-3-ylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 161001235 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 3-ethynylpyridine;2-methyl-4-pyridin-3-ylbut-3-yn-2-ol |
| SMILES | C#Cc1cccnc1.CC(C)(O)C#Cc1cccnc1 |
| InChI | InChI=1S/C10H11NO.C7H5N/c1-10(2,12)6-5-9-4-3-7-11-8-9;1-2-7-4-3-5-8-6-7/h3-4,7-8,12H,1-2H3;1,3-6H |
| InChIKey | TVXFWSSSQPMZTA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|