About 3-ethynylpyridine;2-methyl-4-pyridin-3-ylbut-3-yn-2-ol
3-ethynylpyridine;2-methyl-4-pyridin-3-ylbut-3-yn-2-ol (PubChem CID 161001235) has the molecular formula C17H16N2O
and a molecular weight of 264.33 g/mol. Its IUPAC name is 3-ethynylpyridine;2-methyl-4-pyridin-3-ylbut-3-yn-2-ol.
Molecular Properties
| Compound Name | 3-ethynylpyridine;2-methyl-4-pyridin-3-ylbut-3-yn-2-ol |
| PubChem CID | 161001235 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 3-ethynylpyridine;2-methyl-4-pyridin-3-ylbut-3-yn-2-ol |
| SMILES | C#Cc1cccnc1.CC(C)(O)C#Cc1cccnc1 |
| InChI | InChI=1S/C10H11NO.C7H5N/c1-10(2,12)6-5-9-4-3-7-11-8-9;1-2-7-4-3-5-8-6-7/h3-4,7-8,12H,1-2H3;1,3-6H |
| InChIKey | TVXFWSSSQPMZTA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethynylpyridine;2-methyl-4-pyridin-3-ylbut-3-yn-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethynylpyridine;2-methyl-4-pyridin-3-ylbut-3-yn-2-ol?
The IUPAC name of 3-ethynylpyridine;2-methyl-4-pyridin-3-ylbut-3-yn-2-ol (CID 161001235) is 3-ethynylpyridine;2-methyl-4-pyridin-3-ylbut-3-yn-2-ol.
What is the SMILES notation for 3-ethynylpyridine;2-methyl-4-pyridin-3-ylbut-3-yn-2-ol?
The canonical SMILES for 3-ethynylpyridine;2-methyl-4-pyridin-3-ylbut-3-yn-2-ol is C#Cc1cccnc1.CC(C)(O)C#Cc1cccnc1.
What is the InChIKey of 3-ethynylpyridine;2-methyl-4-pyridin-3-ylbut-3-yn-2-ol?
The InChIKey is TVXFWSSSQPMZTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO.C7H5N/c1-10(2,12)6-5-9-4-3-7-11-8-9;1-2-7-4-3-5-8-6-7/h3-4,7-8,12H,1-2H3;1,3-6H.
What are the key properties of 3-ethynylpyridine;2-methyl-4-pyridin-3-ylbut-3-yn-2-ol?
3-ethynylpyridine;2-methyl-4-pyridin-3-ylbut-3-yn-2-ol has a molecular weight of 264.33 g/mol, XLogP of 2.27, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethynylpyridine;2-methyl-4-pyridin-3-ylbut-3-yn-2-ol is sourced from PubChem (CID 161001235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).