About 2-[4-(1-cyanoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine
2-[4-(1-cyanoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine (PubChem CID 161001500) has the molecular formula C8H11N5S2
and a molecular weight of 241.34 g/mol. Its IUPAC name is 2-[4-(1-cyanoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine.
Molecular Properties
| Compound Name | 2-[4-(1-cyanoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine |
| PubChem CID | 161001500 |
| Molecular Formula | C8H11N5S2 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 2-[4-(1-cyanoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine |
| SMILES | CC(C#N)SCc1csc(N=C(N)N)n1 |
| InChI | InChI=1S/C8H11N5S2/c1-5(2-9)14-3-6-4-15-8(12-6)13-7(10)11/h4-5H,3H2,1H3,(H4,10,11,12,13) |
| InChIKey | TVXZVSURSGUYCJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(1-cyanoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1-cyanoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine?
The IUPAC name of 2-[4-(1-cyanoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine (CID 161001500) is 2-[4-(1-cyanoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine.
What is the SMILES notation for 2-[4-(1-cyanoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine?
The canonical SMILES for 2-[4-(1-cyanoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine is CC(C#N)SCc1csc(N=C(N)N)n1.
What is the InChIKey of 2-[4-(1-cyanoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine?
The InChIKey is TVXZVSURSGUYCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5S2/c1-5(2-9)14-3-6-4-15-8(12-6)13-7(10)11/h4-5H,3H2,1H3,(H4,10,11,12,13).
What are the key properties of 2-[4-(1-cyanoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine?
2-[4-(1-cyanoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine has a molecular weight of 241.34 g/mol, XLogP of 1.19, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1-cyanoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine is sourced from PubChem (CID 161001500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).