C8H11N5S2 — CID 161001500
2-[4-(1-cyanoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine (PubChem CID 161001500) has the molecular formula C8H11N5S2 and a molecular weight of 241.34 g/mol. Its IUPAC name is 2-[4-(1-cyanoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-(1-cyanoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 161001500 |
| Molecular Formula | C8H11N5S2 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 2-[4-(1-cyanoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine |
| SMILES | CC(C#N)SCc1csc(N=C(N)N)n1 |
| InChI | InChI=1S/C8H11N5S2/c1-5(2-9)14-3-6-4-15-8(12-6)13-7(10)11/h4-5H,3H2,1H3,(H4,10,11,12,13) |
| InChIKey | TVXZVSURSGUYCJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|