About (1,4-dimethylimidazol-2-yl)methanol;(1,4-dimethylpyrazol-3-yl)methanol
(1,4-dimethylimidazol-2-yl)methanol;(1,4-dimethylpyrazol-3-yl)methanol (PubChem CID 161001675) has the molecular formula C12H20N4O2
and a molecular weight of 252.32 g/mol. Its IUPAC name is (1,4-dimethylimidazol-2-yl)methanol;(1,4-dimethylpyrazol-3-yl)methanol.
Molecular Properties
| Compound Name | (1,4-dimethylimidazol-2-yl)methanol;(1,4-dimethylpyrazol-3-yl)methanol |
| PubChem CID | 161001675 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (1,4-dimethylimidazol-2-yl)methanol;(1,4-dimethylpyrazol-3-yl)methanol |
| SMILES | Cc1cn(C)c(CO)n1.Cc1cn(C)nc1CO |
| InChI | InChI=1S/2C6H10N2O/c1-5-3-8(2)6(4-9)7-5;1-5-3-8(2)7-6(5)4-9/h2*3,9H,4H2,1-2H3 |
| InChIKey | TVYQCQHMYLHAEB-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1,4-dimethylimidazol-2-yl)methanol;(1,4-dimethylpyrazol-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,4-dimethylimidazol-2-yl)methanol;(1,4-dimethylpyrazol-3-yl)methanol?
The IUPAC name of (1,4-dimethylimidazol-2-yl)methanol;(1,4-dimethylpyrazol-3-yl)methanol (CID 161001675) is (1,4-dimethylimidazol-2-yl)methanol;(1,4-dimethylpyrazol-3-yl)methanol.
What is the SMILES notation for (1,4-dimethylimidazol-2-yl)methanol;(1,4-dimethylpyrazol-3-yl)methanol?
The canonical SMILES for (1,4-dimethylimidazol-2-yl)methanol;(1,4-dimethylpyrazol-3-yl)methanol is Cc1cn(C)c(CO)n1.Cc1cn(C)nc1CO.
What is the InChIKey of (1,4-dimethylimidazol-2-yl)methanol;(1,4-dimethylpyrazol-3-yl)methanol?
The InChIKey is TVYQCQHMYLHAEB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H10N2O/c1-5-3-8(2)6(4-9)7-5;1-5-3-8(2)7-6(5)4-9/h2*3,9H,4H2,1-2H3.
What are the key properties of (1,4-dimethylimidazol-2-yl)methanol;(1,4-dimethylpyrazol-3-yl)methanol?
(1,4-dimethylimidazol-2-yl)methanol;(1,4-dimethylpyrazol-3-yl)methanol has a molecular weight of 252.32 g/mol, XLogP of 0.44, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1,4-dimethylimidazol-2-yl)methanol;(1,4-dimethylpyrazol-3-yl)methanol is sourced from PubChem (CID 161001675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).