C8H21N2O6P — CID 161005171
N,N-dimethylmethanamine;[[2-(2-hydroxyethoxy)-2-oxoethyl]amino]methylphosphonic acid (PubChem CID 161005171) has the molecular formula C8H21N2O6P and a molecular weight of 272.24 g/mol. Its IUPAC name is N,N-dimethylmethanamine;[[2-(2-hydroxyethoxy)-2-oxoethyl]amino]methylphosphonic acid.
| Compound Name | N,N-dimethylmethanamine;[[2-(2-hydroxyethoxy)-2-oxoethyl]amino]methylphosphonic acid |
|---|---|
| PubChem CID | 161005171 |
| Molecular Formula | C8H21N2O6P |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | N,N-dimethylmethanamine;[[2-(2-hydroxyethoxy)-2-oxoethyl]amino]methylphosphonic acid |
| SMILES | CN(C)C.O=C(CNCP(=O)(O)O)OCCO |
| InChI | InChI=1S/C5H12NO6P.C3H9N/c7-1-2-12-5(8)3-6-4-13(9,10)11;1-4(2)3/h6-7H,1-4H2,(H2,9,10,11);1-3H3 |
| InChIKey | TWKGFPVFGLVADN-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|