About ethyl 2-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-2-methyloctanoate;9-hydroxy-3-methylnonan-2-one
ethyl 2-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-2-methyloctanoate;9-hydroxy-3-methylnonan-2-one (PubChem CID 161005334) has the molecular formula C29H58O6Si
and a molecular weight of 530.86 g/mol. Its IUPAC name is ethyl 2-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-2-methyloctanoate;9-hydroxy-3-methylnonan-2-one.
Molecular Properties
| Compound Name | ethyl 2-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-2-methyloctanoate;9-hydroxy-3-methylnonan-2-one |
| PubChem CID | 161005334 |
| Molecular Formula | C29H58O6Si |
| Molecular Weight | 530.86 g/mol |
| Exact Mass | 530.40 |
| IUPAC Name | ethyl 2-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-2-methyloctanoate;9-hydroxy-3-methylnonan-2-one |
| SMILES | CC(=O)C(C)CCCCCCO.CCOC(=O)C(C)(CCCCCCO[Si](C)(C)C(C)(C)C)C(C)=O |
| InChI | InChI=1S/C19H38O4Si.C10H20O2/c1-9-22-17(21)19(6,16(2)20)14-12-10-11-13-15-23-24(7,8)18(3,4)5;1-9(10(2)12)7-5-3-4-6-8-11/h9-15H2,1-8H3;9,11H,3-8H2,1-2H3 |
| InChIKey | TWKRRJMIXDHCQZ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.86 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-2-methyloctanoate;9-hydroxy-3-methylnonan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-2-methyloctanoate;9-hydroxy-3-methylnonan-2-one?
The IUPAC name of ethyl 2-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-2-methyloctanoate;9-hydroxy-3-methylnonan-2-one (CID 161005334) is ethyl 2-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-2-methyloctanoate;9-hydroxy-3-methylnonan-2-one.
What is the SMILES notation for ethyl 2-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-2-methyloctanoate;9-hydroxy-3-methylnonan-2-one?
The canonical SMILES for ethyl 2-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-2-methyloctanoate;9-hydroxy-3-methylnonan-2-one is CC(=O)C(C)CCCCCCO.CCOC(=O)C(C)(CCCCCCO[Si](C)(C)C(C)(C)C)C(C)=O.
What is the InChIKey of ethyl 2-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-2-methyloctanoate;9-hydroxy-3-methylnonan-2-one?
The InChIKey is TWKRRJMIXDHCQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38O4Si.C10H20O2/c1-9-22-17(21)19(6,16(2)20)14-12-10-11-13-15-23-24(7,8)18(3,4)5;1-9(10(2)12)7-5-3-4-6-8-11/h9-15H2,1-8H3;9,11H,3-8H2,1-2H3.
What are the key properties of ethyl 2-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-2-methyloctanoate;9-hydroxy-3-methylnonan-2-one?
ethyl 2-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-2-methyloctanoate;9-hydroxy-3-methylnonan-2-one has a molecular weight of 530.86 g/mol, XLogP of 7.27, 18 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-2-methyloctanoate;9-hydroxy-3-methylnonan-2-one is sourced from PubChem (CID 161005334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).