C26H40O6 — CID 161005726
(7R)-1,4-dioxadispiro[4.1.57.35]pentadec-8-ene;(7R)-7-(4-oxobutyl)-1,4-dioxaspiro[4.5]decane-7-carbaldehyde (PubChem CID 161005726) has the molecular formula C26H40O6 and a molecular weight of 448.60 g/mol. Its IUPAC name is (7R)-1,4-dioxadispiro[4.1.57.35]pentadec-8-ene;(7R)-7-(4-oxobutyl)-1,4-dioxaspiro[4.5]decane-7-carbaldehyde.
| Compound Name | (7R)-1,4-dioxadispiro[4.1.57.35]pentadec-8-ene;(7R)-7-(4-oxobutyl)-1,4-dioxaspiro[4.5]decane-7-carbaldehyde |
|---|---|
| PubChem CID | 161005726 |
| Molecular Formula | C26H40O6 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | (7R)-1,4-dioxadispiro[4.1.57.35]pentadec-8-ene;(7R)-7-(4-oxobutyl)-1,4-dioxaspiro[4.5]decane-7-carbaldehyde |
| SMILES | C1=C[C@]2(CCC1)CCCC1(C2)OCCO1.O=CCCC[C@@]1(C=O)CCCC2(C1)OCCO2 |
| InChI | InChI=1S/C13H20O4.C13H20O2/c14-7-2-1-4-12(11-15)5-3-6-13(10-12)16-8-9-17-13;1-2-5-12(6-3-1)7-4-8-13(11-12)14-9-10-15-13/h7,11H,1-6,8-10H2;2,5H,1,3-4,6-11H2/t2*12-/m10/s1 |
| InChIKey | TWLZEUNBVUNAII-IZIBOJBPSA-N |
| XLogP | 4.89 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|