About N-cyclohexylcyclohexanamine;2-(4-oxo-2-propan-2-yl-2,3-dihydrochromen-6-yl)propanoic acid
N-cyclohexylcyclohexanamine;2-(4-oxo-2-propan-2-yl-2,3-dihydrochromen-6-yl)propanoic acid (PubChem CID 161005824) has the molecular formula C27H41NO4
and a molecular weight of 443.63 g/mol. Its IUPAC name is N-cyclohexylcyclohexanamine;2-(4-oxo-2-propan-2-yl-2,3-dihydrochromen-6-yl)propanoic acid.
Molecular Properties
| Compound Name | N-cyclohexylcyclohexanamine;2-(4-oxo-2-propan-2-yl-2,3-dihydrochromen-6-yl)propanoic acid |
| PubChem CID | 161005824 |
| Molecular Formula | C27H41NO4 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.30 |
| IUPAC Name | N-cyclohexylcyclohexanamine;2-(4-oxo-2-propan-2-yl-2,3-dihydrochromen-6-yl)propanoic acid |
| SMILES | C1CCC(NC2CCCCC2)CC1.CC(C(=O)O)c1ccc2c(c1)C(=O)CC(C(C)C)O2 |
| InChI | InChI=1S/C15H18O4.C12H23N/c1-8(2)14-7-12(16)11-6-10(9(3)15(17)18)4-5-13(11)19-14;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h4-6,8-9,14H,7H2,1-3H3,(H,17,18);11-13H,1-10H2 |
| InChIKey | TWMHMMNCOUZOCM-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclohexylcyclohexanamine;2-(4-oxo-2-propan-2-yl-2,3-dihydrochromen-6-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexylcyclohexanamine;2-(4-oxo-2-propan-2-yl-2,3-dihydrochromen-6-yl)propanoic acid?
The IUPAC name of N-cyclohexylcyclohexanamine;2-(4-oxo-2-propan-2-yl-2,3-dihydrochromen-6-yl)propanoic acid (CID 161005824) is N-cyclohexylcyclohexanamine;2-(4-oxo-2-propan-2-yl-2,3-dihydrochromen-6-yl)propanoic acid.
What is the SMILES notation for N-cyclohexylcyclohexanamine;2-(4-oxo-2-propan-2-yl-2,3-dihydrochromen-6-yl)propanoic acid?
The canonical SMILES for N-cyclohexylcyclohexanamine;2-(4-oxo-2-propan-2-yl-2,3-dihydrochromen-6-yl)propanoic acid is C1CCC(NC2CCCCC2)CC1.CC(C(=O)O)c1ccc2c(c1)C(=O)CC(C(C)C)O2.
What is the InChIKey of N-cyclohexylcyclohexanamine;2-(4-oxo-2-propan-2-yl-2,3-dihydrochromen-6-yl)propanoic acid?
The InChIKey is TWMHMMNCOUZOCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O4.C12H23N/c1-8(2)14-7-12(16)11-6-10(9(3)15(17)18)4-5-13(11)19-14;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h4-6,8-9,14H,7H2,1-3H3,(H,17,18);11-13H,1-10H2.
What are the key properties of N-cyclohexylcyclohexanamine;2-(4-oxo-2-propan-2-yl-2,3-dihydrochromen-6-yl)propanoic acid?
N-cyclohexylcyclohexanamine;2-(4-oxo-2-propan-2-yl-2,3-dihydrochromen-6-yl)propanoic acid has a molecular weight of 443.63 g/mol, XLogP of 6.11, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexylcyclohexanamine;2-(4-oxo-2-propan-2-yl-2,3-dihydrochromen-6-yl)propanoic acid is sourced from PubChem (CID 161005824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).