About [(2R,3R)-3-butyloxiran-2-yl]methanol;(E)-hept-2-en-1-ol
[(2R,3R)-3-butyloxiran-2-yl]methanol;(E)-hept-2-en-1-ol (PubChem CID 161006009) has the molecular formula C14H28O3
and a molecular weight of 244.37 g/mol. Its IUPAC name is [(2R,3R)-3-butyloxiran-2-yl]methanol;(E)-hept-2-en-1-ol.
Molecular Properties
| Compound Name | [(2R,3R)-3-butyloxiran-2-yl]methanol;(E)-hept-2-en-1-ol |
| PubChem CID | 161006009 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | [(2R,3R)-3-butyloxiran-2-yl]methanol;(E)-hept-2-en-1-ol |
| SMILES | CCCC/C=C/CO.CCCC[C@H]1O[C@@H]1CO |
| InChI | InChI=1S/C7H14O2.C7H14O/c1-2-3-4-6-7(5-8)9-6;1-2-3-4-5-6-7-8/h6-8H,2-5H2,1H3;5-6,8H,2-4,7H2,1H3/b;6-5+/t6-,7-;/m1./s1 |
| InChIKey | TWMWRZLFEJJRRH-WKKWVCLBSA-N |
| XLogP | 2.66 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3R)-3-butyloxiran-2-yl]methanol;(E)-hept-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R)-3-butyloxiran-2-yl]methanol;(E)-hept-2-en-1-ol?
The IUPAC name of [(2R,3R)-3-butyloxiran-2-yl]methanol;(E)-hept-2-en-1-ol (CID 161006009) is [(2R,3R)-3-butyloxiran-2-yl]methanol;(E)-hept-2-en-1-ol.
What is the SMILES notation for [(2R,3R)-3-butyloxiran-2-yl]methanol;(E)-hept-2-en-1-ol?
The canonical SMILES for [(2R,3R)-3-butyloxiran-2-yl]methanol;(E)-hept-2-en-1-ol is CCCC/C=C/CO.CCCC[C@H]1O[C@@H]1CO.
What is the InChIKey of [(2R,3R)-3-butyloxiran-2-yl]methanol;(E)-hept-2-en-1-ol?
The InChIKey is TWMWRZLFEJJRRH-WKKWVCLBSA-N. The full InChI is InChI=1S/C7H14O2.C7H14O/c1-2-3-4-6-7(5-8)9-6;1-2-3-4-5-6-7-8/h6-8H,2-5H2,1H3;5-6,8H,2-4,7H2,1H3/b;6-5+/t6-,7-;/m1./s1.
What are the key properties of [(2R,3R)-3-butyloxiran-2-yl]methanol;(E)-hept-2-en-1-ol?
[(2R,3R)-3-butyloxiran-2-yl]methanol;(E)-hept-2-en-1-ol has a molecular weight of 244.37 g/mol, XLogP of 2.66, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R)-3-butyloxiran-2-yl]methanol;(E)-hept-2-en-1-ol is sourced from PubChem (CID 161006009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).