C42H26O5U2-2 — CID 161006179
4,5-dimethyl-10-naphthalen-2-yl-9-naphtho[1,2-b][1]benzofuran-9-yl-2,7-dihydroanthracene-2,7-diide-1,3,6,8-tetrol;uranium (PubChem CID 161006179) has the molecular formula C42H26O5U2-2 and a molecular weight of 1086.72 g/mol. Its IUPAC name is 4,5-dimethyl-10-naphthalen-2-yl-9-naphtho[1,2-b][1]benzofuran-9-yl-2,7-dihydroanthracene-2,7-diide-1,3,6,8-tetrol;uranium.
| Compound Name | 4,5-dimethyl-10-naphthalen-2-yl-9-naphtho[1,2-b][1]benzofuran-9-yl-2,7-dihydroanthracene-2,7-diide-1,3,6,8-tetrol;uranium |
|---|---|
| PubChem CID | 161006179 |
| Molecular Formula | C42H26O5U2-2 |
| Molecular Weight | 1086.72 g/mol |
| Exact Mass | 1086.28 |
| IUPAC Name | 4,5-dimethyl-10-naphthalen-2-yl-9-naphtho[1,2-b][1]benzofuran-9-yl-2,7-dihydroanthracene-2,7-diide-1,3,6,8-tetrol;uranium |
| SMILES | Cc1c(O)[c-]c(O)c2c(-c3ccc4c(c3)oc3c5ccccc5ccc43)c3c(O)[c-]c(O)c(C)c3c(-c3ccc4ccccc4c3)c12.[U].[U] |
| InChI | InChI=1S/C42H26O5.2U/c1-21-31(43)19-33(45)40-36(21)38(26-12-11-23-7-3-4-9-25(23)17-26)37-22(2)32(44)20-34(46)41(37)39(40)27-14-15-29-30-16-13-24-8-5-6-10-28(24)42(30)47-35(29)18-27;;/h3-18,43-46H,1-2H3;;/q-2;; |
| InChIKey | HDKFDRAKHALGEI-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1086.72 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|