C40H46N3O+ — CID 161007210
4-[2-[2-(3,3-dimethyl-1-propylindol-1-ium-2-yl)ethenyl]-6-[2-(1-propyl-3H-indol-2-ylidene)ethylidene]cyclohexen-1-yl]oxyaniline (PubChem CID 161007210) has the molecular formula C40H46N3O+ and a molecular weight of 584.83 g/mol. Its IUPAC name is 4-[2-[2-(3,3-dimethyl-1-propylindol-1-ium-2-yl)ethenyl]-6-[2-(1-propyl-3H-indol-2-ylidene)ethylidene]cyclohexen-1-yl]oxyaniline.
| Compound Name | 4-[2-[2-(3,3-dimethyl-1-propylindol-1-ium-2-yl)ethenyl]-6-[2-(1-propyl-3H-indol-2-ylidene)ethylidene]cyclohexen-1-yl]oxyaniline |
|---|---|
| PubChem CID | 161007210 |
| Molecular Formula | C40H46N3O+ |
| Molecular Weight | 584.83 g/mol |
| Exact Mass | 584.36 |
| IUPAC Name | 4-[2-[2-(3,3-dimethyl-1-propylindol-1-ium-2-yl)ethenyl]-6-[2-(1-propyl-3H-indol-2-ylidene)ethylidene]cyclohexen-1-yl]oxyaniline |
| SMILES | CCCN1C(=CC=C2CCCC(C=CC3=[N+](CCC)c4ccccc4C3(C)C)=C2Oc2ccc(N)cc2)Cc2ccccc21 |
| InChI | InChI=1S/C40H46N3O/c1-5-26-42-33(28-31-12-7-9-16-36(31)42)22-18-29-13-11-14-30(39(29)44-34-23-20-32(41)21-24-34)19-25-38-40(3,4)35-15-8-10-17-37(35)43(38)27-6-2/h7-10,12,15-25H,5-6,11,13-14,26-28,41H2,1-4H3/q+1 |
| InChIKey | GZECLDZOPAOJQJ-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 41.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.83 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|