About ethyl 3-oxobutanoate;4-methyl-7,8-dihydro-6H-chromene-2,5-dione
ethyl 3-oxobutanoate;4-methyl-7,8-dihydro-6H-chromene-2,5-dione (PubChem CID 161007213) has the molecular formula C16H20O6
and a molecular weight of 308.33 g/mol. Its IUPAC name is ethyl 3-oxobutanoate;4-methyl-7,8-dihydro-6H-chromene-2,5-dione.
Molecular Properties
| Compound Name | ethyl 3-oxobutanoate;4-methyl-7,8-dihydro-6H-chromene-2,5-dione |
| PubChem CID | 161007213 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | ethyl 3-oxobutanoate;4-methyl-7,8-dihydro-6H-chromene-2,5-dione |
| SMILES | CCOC(=O)CC(C)=O.Cc1cc(=O)oc2c1C(=O)CCC2 |
| InChI | InChI=1S/C10H10O3.C6H10O3/c1-6-5-9(12)13-8-4-2-3-7(11)10(6)8;1-3-9-6(8)4-5(2)7/h5H,2-4H2,1H3;3-4H2,1-2H3 |
| InChIKey | TWQTWNMOQFNPLM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 90.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-oxobutanoate;4-methyl-7,8-dihydro-6H-chromene-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-oxobutanoate;4-methyl-7,8-dihydro-6H-chromene-2,5-dione?
The IUPAC name of ethyl 3-oxobutanoate;4-methyl-7,8-dihydro-6H-chromene-2,5-dione (CID 161007213) is ethyl 3-oxobutanoate;4-methyl-7,8-dihydro-6H-chromene-2,5-dione.
What is the SMILES notation for ethyl 3-oxobutanoate;4-methyl-7,8-dihydro-6H-chromene-2,5-dione?
The canonical SMILES for ethyl 3-oxobutanoate;4-methyl-7,8-dihydro-6H-chromene-2,5-dione is CCOC(=O)CC(C)=O.Cc1cc(=O)oc2c1C(=O)CCC2.
What is the InChIKey of ethyl 3-oxobutanoate;4-methyl-7,8-dihydro-6H-chromene-2,5-dione?
The InChIKey is TWQTWNMOQFNPLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3.C6H10O3/c1-6-5-9(12)13-8-4-2-3-7(11)10(6)8;1-3-9-6(8)4-5(2)7/h5H,2-4H2,1H3;3-4H2,1-2H3.
What are the key properties of ethyl 3-oxobutanoate;4-methyl-7,8-dihydro-6H-chromene-2,5-dione?
ethyl 3-oxobutanoate;4-methyl-7,8-dihydro-6H-chromene-2,5-dione has a molecular weight of 308.33 g/mol, XLogP of 2.00, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-oxobutanoate;4-methyl-7,8-dihydro-6H-chromene-2,5-dione is sourced from PubChem (CID 161007213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).