C13H12F4N2O — CID 161007546
1-(2-ethyl-3-fluoro-4-methoxyphenyl)-3-(trifluoromethyl)pyrazole (PubChem CID 161007546) has the molecular formula C13H12F4N2O and a molecular weight of 288.24 g/mol. Its IUPAC name is 1-(2-ethyl-3-fluoro-4-methoxyphenyl)-3-(trifluoromethyl)pyrazole.
| Compound Name | 1-(2-ethyl-3-fluoro-4-methoxyphenyl)-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 161007546 |
| Molecular Formula | C13H12F4N2O |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1-(2-ethyl-3-fluoro-4-methoxyphenyl)-3-(trifluoromethyl)pyrazole |
| SMILES | CCc1c(-n2ccc(C(F)(F)F)n2)ccc(OC)c1F |
| InChI | InChI=1S/C13H12F4N2O/c1-3-8-9(4-5-10(20-2)12(8)14)19-7-6-11(18-19)13(15,16)17/h4-7H,3H2,1-2H3 |
| InChIKey | ZPXXORFSQZTKQN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |