About (4R)-1-tert-butyl-4-(2,3,5-trifluorophenyl)pyrrolidin-2-ol
(4R)-1-tert-butyl-4-(2,3,5-trifluorophenyl)pyrrolidin-2-ol (PubChem CID 161008700) has the molecular formula C14H18F3NO
and a molecular weight of 273.30 g/mol. Its IUPAC name is (4R)-1-tert-butyl-4-(2,3,5-trifluorophenyl)pyrrolidin-2-ol.
Molecular Properties
| Compound Name | (4R)-1-tert-butyl-4-(2,3,5-trifluorophenyl)pyrrolidin-2-ol |
| PubChem CID | 161008700 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | (4R)-1-tert-butyl-4-(2,3,5-trifluorophenyl)pyrrolidin-2-ol |
| SMILES | CC(C)(C)N1C[C@@H](c2cc(F)cc(F)c2F)CC1O |
| InChI | InChI=1S/C14H18F3NO/c1-14(2,3)18-7-8(4-12(18)19)10-5-9(15)6-11(16)13(10)17/h5-6,8,12,19H,4,7H2,1-3H3/t8-,12?/m0/s1 |
| InChIKey | TWVQPXHHIZPPOP-KBPLZSHQSA-N |
| XLogP | 3.01 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (4R)-1-tert-butyl-4-(2,3,5-trifluorophenyl)pyrrolidin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1-tert-butyl-4-(2,3,5-trifluorophenyl)pyrrolidin-2-ol?
The IUPAC name of (4R)-1-tert-butyl-4-(2,3,5-trifluorophenyl)pyrrolidin-2-ol (CID 161008700) is (4R)-1-tert-butyl-4-(2,3,5-trifluorophenyl)pyrrolidin-2-ol.
What is the SMILES notation for (4R)-1-tert-butyl-4-(2,3,5-trifluorophenyl)pyrrolidin-2-ol?
The canonical SMILES for (4R)-1-tert-butyl-4-(2,3,5-trifluorophenyl)pyrrolidin-2-ol is CC(C)(C)N1C[C@@H](c2cc(F)cc(F)c2F)CC1O.
What is the InChIKey of (4R)-1-tert-butyl-4-(2,3,5-trifluorophenyl)pyrrolidin-2-ol?
The InChIKey is TWVQPXHHIZPPOP-KBPLZSHQSA-N. The full InChI is InChI=1S/C14H18F3NO/c1-14(2,3)18-7-8(4-12(18)19)10-5-9(15)6-11(16)13(10)17/h5-6,8,12,19H,4,7H2,1-3H3/t8-,12?/m0/s1.
What are the key properties of (4R)-1-tert-butyl-4-(2,3,5-trifluorophenyl)pyrrolidin-2-ol?
(4R)-1-tert-butyl-4-(2,3,5-trifluorophenyl)pyrrolidin-2-ol has a molecular weight of 273.30 g/mol, XLogP of 3.01, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1-tert-butyl-4-(2,3,5-trifluorophenyl)pyrrolidin-2-ol is sourced from PubChem (CID 161008700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).