About 2-methylprop-1-ene;propane-1,2-diol
2-methylprop-1-ene;propane-1,2-diol (PubChem CID 161010082) has the molecular formula C7H16O2
and a molecular weight of 132.20 g/mol. Its IUPAC name is 2-methylprop-1-ene;propane-1,2-diol.
Molecular Properties
| Compound Name | 2-methylprop-1-ene;propane-1,2-diol |
| PubChem CID | 161010082 |
| Molecular Formula | C7H16O2 |
| Molecular Weight | 132.20 g/mol |
| Exact Mass | 132.12 |
| IUPAC Name | 2-methylprop-1-ene;propane-1,2-diol |
| SMILES | C=C(C)C.CC(O)CO |
| InChI | InChI=1S/C4H8.C3H8O2/c1-4(2)3;1-3(5)2-4/h1H2,2-3H3;3-5H,2H2,1H3 |
| InChIKey | TXACYVNDUZCUJB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.20 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-1-ene;propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-1-ene;propane-1,2-diol?
The IUPAC name of 2-methylprop-1-ene;propane-1,2-diol (CID 161010082) is 2-methylprop-1-ene;propane-1,2-diol.
What is the SMILES notation for 2-methylprop-1-ene;propane-1,2-diol?
The canonical SMILES for 2-methylprop-1-ene;propane-1,2-diol is C=C(C)C.CC(O)CO.
What is the InChIKey of 2-methylprop-1-ene;propane-1,2-diol?
The InChIKey is TXACYVNDUZCUJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8.C3H8O2/c1-4(2)3;1-3(5)2-4/h1H2,2-3H3;3-5H,2H2,1H3.
What are the key properties of 2-methylprop-1-ene;propane-1,2-diol?
2-methylprop-1-ene;propane-1,2-diol has a molecular weight of 132.20 g/mol, XLogP of 0.94, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-1-ene;propane-1,2-diol is sourced from PubChem (CID 161010082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).