About 1-methylpiperazine;N-phenylaniline
1-methylpiperazine;N-phenylaniline (PubChem CID 161010175) has the molecular formula C17H23N3
and a molecular weight of 269.39 g/mol. Its IUPAC name is 1-methylpiperazine;N-phenylaniline.
Molecular Properties
| Compound Name | 1-methylpiperazine;N-phenylaniline |
| PubChem CID | 161010175 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 1-methylpiperazine;N-phenylaniline |
| SMILES | CN1CCNCC1.c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11N.C5H12N2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-7-4-2-6-3-5-7/h1-10,13H;6H,2-5H2,1H3 |
| InChIKey | TXALWJDKHWLYQO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methylpiperazine;N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpiperazine;N-phenylaniline?
The IUPAC name of 1-methylpiperazine;N-phenylaniline (CID 161010175) is 1-methylpiperazine;N-phenylaniline.
What is the SMILES notation for 1-methylpiperazine;N-phenylaniline?
The canonical SMILES for 1-methylpiperazine;N-phenylaniline is CN1CCNCC1.c1ccc(Nc2ccccc2)cc1.
What is the InChIKey of 1-methylpiperazine;N-phenylaniline?
The InChIKey is TXALWJDKHWLYQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.C5H12N2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-7-4-2-6-3-5-7/h1-10,13H;6H,2-5H2,1H3.
What are the key properties of 1-methylpiperazine;N-phenylaniline?
1-methylpiperazine;N-phenylaniline has a molecular weight of 269.39 g/mol, XLogP of 2.95, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpiperazine;N-phenylaniline is sourced from PubChem (CID 161010175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).