C26H37FN2O7S — CID 161010289
tert-butyl 3-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpentyl]-2,5-dioxoimidazolidine-1-carboxylate (PubChem CID 161010289) has the molecular formula C26H37FN2O7S and a molecular weight of 540.65 g/mol. Its IUPAC name is tert-butyl 3-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpentyl]-2,5-dioxoimidazolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpentyl]-2,5-dioxoimidazolidine-1-carboxylate |
|---|---|
| PubChem CID | 161010289 |
| Molecular Formula | C26H37FN2O7S |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | tert-butyl 3-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpentyl]-2,5-dioxoimidazolidine-1-carboxylate |
| SMILES | C[C@@H](CS(=O)(=O)CCCCCN1CC(=O)N(C(=O)OC(C)(C)C)C1=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C26H37FN2O7S/c1-18(20-10-11-21(27)22(14-20)35-16-19-8-9-19)17-37(33,34)13-7-5-6-12-28-15-23(30)29(24(28)31)25(32)36-26(2,3)4/h10-11,14,18-19H,5-9,12-13,15-17H2,1-4H3/t18-/m0/s1 |
| InChIKey | MLUCIYHRBFUYLK-SFHVURJKSA-N |
| XLogP | 4.50 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|