C25H29N5O7 — CID 161010308
1-(6-methoxy-1,5-naphthyridin-4-yl)-4-(2-phenoxyethylamino)piperidine-2-carboxamide;oxalic acid (PubChem CID 161010308) has the molecular formula C25H29N5O7 and a molecular weight of 511.54 g/mol. Its IUPAC name is 1-(6-methoxy-1,5-naphthyridin-4-yl)-4-(2-phenoxyethylamino)piperidine-2-carboxamide;oxalic acid.
| Compound Name | 1-(6-methoxy-1,5-naphthyridin-4-yl)-4-(2-phenoxyethylamino)piperidine-2-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 161010308 |
| Molecular Formula | C25H29N5O7 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | 1-(6-methoxy-1,5-naphthyridin-4-yl)-4-(2-phenoxyethylamino)piperidine-2-carboxamide;oxalic acid |
| SMILES | COc1ccc2nccc(N3CCC(NCCOc4ccccc4)CC3C(N)=O)c2n1.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H27N5O3.C2H2O4/c1-30-21-8-7-18-22(27-21)19(9-11-26-18)28-13-10-16(15-20(28)23(24)29)25-12-14-31-17-5-3-2-4-6-17;3-1(4)2(5)6/h2-9,11,16,20,25H,10,12-15H2,1H3,(H2,24,29);(H,3,4)(H,5,6) |
| InChIKey | BVVONHCOUAJCQE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 177.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|