C21H28O4 — CID 161010907
6-[3,4-bis(trideuteriomethoxy)phenyl]-2,3,3,5,5,6,6-heptadeuterio-1-(3-methylphenoxy)hexan-2-ol (PubChem CID 161010907) has the molecular formula C21H28O4 and a molecular weight of 357.53 g/mol. Its IUPAC name is 6-[3,4-bis(trideuteriomethoxy)phenyl]-2,3,3,5,5,6,6-heptadeuterio-1-(3-methylphenoxy)hexan-2-ol.
| Compound Name | 6-[3,4-bis(trideuteriomethoxy)phenyl]-2,3,3,5,5,6,6-heptadeuterio-1-(3-methylphenoxy)hexan-2-ol |
|---|---|
| PubChem CID | 161010907 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 357.53 g/mol |
| Exact Mass | 357.28 |
| IUPAC Name | 6-[3,4-bis(trideuteriomethoxy)phenyl]-2,3,3,5,5,6,6-heptadeuterio-1-(3-methylphenoxy)hexan-2-ol |
| SMILES | [2H]C([2H])([2H])Oc1ccc(C([2H])([2H])C([2H])([2H])CC([2H])([2H])C([2H])(O)COc2cccc(C)c2)cc1OC([2H])([2H])[2H] |
| InChI | InChI=1S/C21H28O4/c1-16-7-6-10-19(13-16)25-15-18(22)9-5-4-8-17-11-12-20(23-2)21(14-17)24-3/h6-7,10-14,18,22H,4-5,8-9,15H2,1-3H3/i2D3,3D3,4D2,8D2,9D2,18D |
| InChIKey | OXAGHCVBQFNTPQ-VCODTBNXSA-N |
| XLogP | 4.16 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |