C22H23FN2O — CID 161011246
2-(2-amino-4-fluorophenyl)-1-[4-[[1-(cyclopropylmethyl)azetidin-3-ylidene]methyl]phenyl]ethanone (PubChem CID 161011246) has the molecular formula C22H23FN2O and a molecular weight of 350.44 g/mol. Its IUPAC name is 2-(2-amino-4-fluorophenyl)-1-[4-[[1-(cyclopropylmethyl)azetidin-3-ylidene]methyl]phenyl]ethanone.
| Compound Name | 2-(2-amino-4-fluorophenyl)-1-[4-[[1-(cyclopropylmethyl)azetidin-3-ylidene]methyl]phenyl]ethanone |
|---|---|
| PubChem CID | 161011246 |
| Molecular Formula | C22H23FN2O |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 2-(2-amino-4-fluorophenyl)-1-[4-[[1-(cyclopropylmethyl)azetidin-3-ylidene]methyl]phenyl]ethanone |
| SMILES | Nc1cc(F)ccc1CC(=O)c1ccc(C=C2CN(CC3CC3)C2)cc1 |
| InChI | InChI=1S/C22H23FN2O/c23-20-8-7-19(21(24)11-20)10-22(26)18-5-3-15(4-6-18)9-17-13-25(14-17)12-16-1-2-16/h3-9,11,16H,1-2,10,12-14,24H2 |
| InChIKey | XYLIEAKUBFEJDP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|