C20H23ClN8OS2 — CID 161011337
2-[(2S,3S)-1-(4-amino-6-methyl-1,3,5-triazin-2-yl)-3-methylazetidin-2-yl]-5-chloro-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one;sulfane (PubChem CID 161011337) has the molecular formula C20H23ClN8OS2 and a molecular weight of 491.05 g/mol. Its IUPAC name is 2-[(2S,3S)-1-(4-amino-6-methyl-1,3,5-triazin-2-yl)-3-methylazetidin-2-yl]-5-chloro-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one;sulfane.
| Compound Name | 2-[(2S,3S)-1-(4-amino-6-methyl-1,3,5-triazin-2-yl)-3-methylazetidin-2-yl]-5-chloro-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one;sulfane |
|---|---|
| PubChem CID | 161011337 |
| Molecular Formula | C20H23ClN8OS2 |
| Molecular Weight | 491.05 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 2-[(2S,3S)-1-(4-amino-6-methyl-1,3,5-triazin-2-yl)-3-methylazetidin-2-yl]-5-chloro-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one;sulfane |
| SMILES | Cc1nc(N)nc(N2C[C@H](C)[C@H]2c2nn3ccc(Cl)c3c(=O)n2-c2ccccc2)n1.S.S |
| InChI | InChI=1S/C20H19ClN8O.2H2S/c1-11-10-27(20-24-12(2)23-19(22)25-20)15(11)17-26-28-9-8-14(21)16(28)18(30)29(17)13-6-4-3-5-7-13;;/h3-9,11,15H,10H2,1-2H3,(H2,22,23,24,25);2*1H2/t11-,15-;;/m0../s1 |
| InChIKey | TXDRUGGPMOMFHF-TYKVKQJJSA-N |
| XLogP | 2.64 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.05 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |