About 5-(4,4-difluoropiperidin-1-yl)-7-oxo-8H-isoquinoline-6-carbonitrile
5-(4,4-difluoropiperidin-1-yl)-7-oxo-8H-isoquinoline-6-carbonitrile (PubChem CID 161012264) has the molecular formula C15H13F2N3O
and a molecular weight of 289.28 g/mol. Its IUPAC name is 5-(4,4-difluoropiperidin-1-yl)-7-oxo-8H-isoquinoline-6-carbonitrile.
Molecular Properties
| Compound Name | 5-(4,4-difluoropiperidin-1-yl)-7-oxo-8H-isoquinoline-6-carbonitrile |
| PubChem CID | 161012264 |
| Molecular Formula | C15H13F2N3O |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 5-(4,4-difluoropiperidin-1-yl)-7-oxo-8H-isoquinoline-6-carbonitrile |
| SMILES | N#CC1=C(N2CCC(F)(F)CC2)c2ccncc2CC1=O |
| InChI | InChI=1S/C15H13F2N3O/c16-15(17)2-5-20(6-3-15)14-11-1-4-19-9-10(11)7-13(21)12(14)8-18/h1,4,9H,2-3,5-7H2 |
| InChIKey | TXGVBHGLYDCQNO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4,4-difluoropiperidin-1-yl)-7-oxo-8H-isoquinoline-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,4-difluoropiperidin-1-yl)-7-oxo-8H-isoquinoline-6-carbonitrile?
The IUPAC name of 5-(4,4-difluoropiperidin-1-yl)-7-oxo-8H-isoquinoline-6-carbonitrile (CID 161012264) is 5-(4,4-difluoropiperidin-1-yl)-7-oxo-8H-isoquinoline-6-carbonitrile.
What is the SMILES notation for 5-(4,4-difluoropiperidin-1-yl)-7-oxo-8H-isoquinoline-6-carbonitrile?
The canonical SMILES for 5-(4,4-difluoropiperidin-1-yl)-7-oxo-8H-isoquinoline-6-carbonitrile is N#CC1=C(N2CCC(F)(F)CC2)c2ccncc2CC1=O.
What is the InChIKey of 5-(4,4-difluoropiperidin-1-yl)-7-oxo-8H-isoquinoline-6-carbonitrile?
The InChIKey is TXGVBHGLYDCQNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F2N3O/c16-15(17)2-5-20(6-3-15)14-11-1-4-19-9-10(11)7-13(21)12(14)8-18/h1,4,9H,2-3,5-7H2.
What are the key properties of 5-(4,4-difluoropiperidin-1-yl)-7-oxo-8H-isoquinoline-6-carbonitrile?
5-(4,4-difluoropiperidin-1-yl)-7-oxo-8H-isoquinoline-6-carbonitrile has a molecular weight of 289.28 g/mol, XLogP of 2.17, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,4-difluoropiperidin-1-yl)-7-oxo-8H-isoquinoline-6-carbonitrile is sourced from PubChem (CID 161012264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).