C24H35FN4O5 — CID 161013427
(8aS)-2-[2-fluoro-4-(4-methylpiperidin-1-yl)phenyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one;tert-butyl formate;carbon dioxide (PubChem CID 161013427) has the molecular formula C24H35FN4O5 and a molecular weight of 478.57 g/mol. Its IUPAC name is (8aS)-2-[2-fluoro-4-(4-methylpiperidin-1-yl)phenyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one;tert-butyl formate;carbon dioxide.
| Compound Name | (8aS)-2-[2-fluoro-4-(4-methylpiperidin-1-yl)phenyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one;tert-butyl formate;carbon dioxide |
|---|---|
| PubChem CID | 161013427 |
| Molecular Formula | C24H35FN4O5 |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | (8aS)-2-[2-fluoro-4-(4-methylpiperidin-1-yl)phenyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one;tert-butyl formate;carbon dioxide |
| SMILES | CC(C)(C)OC=O.CC1CCN(c2ccc(N3C[C@@H]4CNCCN4C3=O)c(F)c2)CC1.O=C=O |
| InChI | InChI=1S/C18H25FN4O.C5H10O2.CO2/c1-13-4-7-21(8-5-13)14-2-3-17(16(19)10-14)23-12-15-11-20-6-9-22(15)18(23)24;1-5(2,3)7-4-6;2-1-3/h2-3,10,13,15,20H,4-9,11-12H2,1H3;4H,1-3H3;/t15-;;/m0../s1 |
| InChIKey | TXKIYIXTTSVXJG-CKUXDGONSA-N |
| XLogP | 2.65 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|