About 1,2-diethyl-4-isocyanatobenzene;1,3-diethyl-5-isocyanatobenzene
1,2-diethyl-4-isocyanatobenzene;1,3-diethyl-5-isocyanatobenzene (PubChem CID 161013901) has the molecular formula C22H26N2O2
and a molecular weight of 350.46 g/mol. Its IUPAC name is 1,2-diethyl-4-isocyanatobenzene;1,3-diethyl-5-isocyanatobenzene.
Molecular Properties
| Compound Name | 1,2-diethyl-4-isocyanatobenzene;1,3-diethyl-5-isocyanatobenzene |
| PubChem CID | 161013901 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 1,2-diethyl-4-isocyanatobenzene;1,3-diethyl-5-isocyanatobenzene |
| SMILES | CCc1cc(CC)cc(N=C=O)c1.CCc1ccc(N=C=O)cc1CC |
| InChI | InChI=1S/2C11H13NO/c1-3-9-5-10(4-2)7-11(6-9)12-8-13;1-3-9-5-6-11(12-8-13)7-10(9)4-2/h2*5-7H,3-4H2,1-2H3 |
| InChIKey | TXLYRFFEUZWKNA-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diethyl-4-isocyanatobenzene;1,3-diethyl-5-isocyanatobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diethyl-4-isocyanatobenzene;1,3-diethyl-5-isocyanatobenzene?
The IUPAC name of 1,2-diethyl-4-isocyanatobenzene;1,3-diethyl-5-isocyanatobenzene (CID 161013901) is 1,2-diethyl-4-isocyanatobenzene;1,3-diethyl-5-isocyanatobenzene.
What is the SMILES notation for 1,2-diethyl-4-isocyanatobenzene;1,3-diethyl-5-isocyanatobenzene?
The canonical SMILES for 1,2-diethyl-4-isocyanatobenzene;1,3-diethyl-5-isocyanatobenzene is CCc1cc(CC)cc(N=C=O)c1.CCc1ccc(N=C=O)cc1CC.
What is the InChIKey of 1,2-diethyl-4-isocyanatobenzene;1,3-diethyl-5-isocyanatobenzene?
The InChIKey is TXLYRFFEUZWKNA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H13NO/c1-3-9-5-10(4-2)7-11(6-9)12-8-13;1-3-9-5-6-11(12-8-13)7-10(9)4-2/h2*5-7H,3-4H2,1-2H3.
What are the key properties of 1,2-diethyl-4-isocyanatobenzene;1,3-diethyl-5-isocyanatobenzene?
1,2-diethyl-4-isocyanatobenzene;1,3-diethyl-5-isocyanatobenzene has a molecular weight of 350.46 g/mol, XLogP of 5.56, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diethyl-4-isocyanatobenzene;1,3-diethyl-5-isocyanatobenzene is sourced from PubChem (CID 161013901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).