C21H18FN5O3 — CID 161014679
1-(2-ethyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-2-[6-(4-fluorophenyl)-3-nitro-2-pyridinyl]ethanone (PubChem CID 161014679) has the molecular formula C21H18FN5O3 and a molecular weight of 407.41 g/mol. Its IUPAC name is 1-(2-ethyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-2-[6-(4-fluorophenyl)-3-nitro-2-pyridinyl]ethanone.
| Compound Name | 1-(2-ethyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-2-[6-(4-fluorophenyl)-3-nitro-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 161014679 |
| Molecular Formula | C21H18FN5O3 |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 1-(2-ethyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-2-[6-(4-fluorophenyl)-3-nitro-2-pyridinyl]ethanone |
| SMILES | CCc1ncc2c(n1)CN(C(=O)Cc1nc(-c3ccc(F)cc3)ccc1[N+](=O)[O-])C2 |
| InChI | InChI=1S/C21H18FN5O3/c1-2-20-23-10-14-11-26(12-18(14)25-20)21(28)9-17-19(27(29)30)8-7-16(24-17)13-3-5-15(22)6-4-13/h3-8,10H,2,9,11-12H2,1H3 |
| InChIKey | XHOICQZTYIBEIR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 102.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|