About N'-methylethanimidamide;vanadium
N'-methylethanimidamide;vanadium (PubChem CID 161014708) has the molecular formula C3H8N2V
and a molecular weight of 123.06 g/mol. Its IUPAC name is N'-methylethanimidamide;vanadium.
Molecular Properties
| Compound Name | N'-methylethanimidamide;vanadium |
| PubChem CID | 161014708 |
| Molecular Formula | C3H8N2V |
| Molecular Weight | 123.06 g/mol |
| Exact Mass | 123.01 |
| IUPAC Name | N'-methylethanimidamide;vanadium |
| SMILES | C/N=C(\C)N.[V] |
| InChI | InChI=1S/C3H8N2.V/c1-3(4)5-2;/h1-2H3,(H2,4,5); |
| InChIKey | TXOOSSIKSPFRKQ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.06 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-methylethanimidamide;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methylethanimidamide;vanadium?
The IUPAC name of N'-methylethanimidamide;vanadium (CID 161014708) is N'-methylethanimidamide;vanadium.
What is the SMILES notation for N'-methylethanimidamide;vanadium?
The canonical SMILES for N'-methylethanimidamide;vanadium is C/N=C(\C)N.[V].
What is the InChIKey of N'-methylethanimidamide;vanadium?
The InChIKey is TXOOSSIKSPFRKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2.V/c1-3(4)5-2;/h1-2H3,(H2,4,5);.
What are the key properties of N'-methylethanimidamide;vanadium?
N'-methylethanimidamide;vanadium has a molecular weight of 123.06 g/mol, XLogP of -0.01, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methylethanimidamide;vanadium is sourced from PubChem (CID 161014708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).