About potassium;nitrous acid;chlorate
potassium;nitrous acid;chlorate (PubChem CID 161014710) has the molecular formula HClKNO5
and a molecular weight of 169.56 g/mol. Its IUPAC name is potassium;nitrous acid;chlorate.
Molecular Properties
| Compound Name | potassium;nitrous acid;chlorate |
| PubChem CID | 161014710 |
| Molecular Formula | HClKNO5 |
| Molecular Weight | 169.56 g/mol |
| Exact Mass | 168.92 |
| IUPAC Name | potassium;nitrous acid;chlorate |
| SMILES | O=NO.[K+].[O-][Cl+2]([O-])[O-] |
| InChI | InChI=1S/ClO3.K.HNO2/c2-1(3)4;;2-1-3/h;;(H,2,3)/q-1;+1; |
| InChIKey | HROJLZKNXGNWIY-UHFFFAOYSA-N |
| XLogP | -6.42 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.56 |
| LogP ≤ 5 | -6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze potassium;nitrous acid;chlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;nitrous acid;chlorate?
The IUPAC name of potassium;nitrous acid;chlorate (CID 161014710) is potassium;nitrous acid;chlorate.
What is the SMILES notation for potassium;nitrous acid;chlorate?
The canonical SMILES for potassium;nitrous acid;chlorate is O=NO.[K+].[O-][Cl+2]([O-])[O-].
What is the InChIKey of potassium;nitrous acid;chlorate?
The InChIKey is HROJLZKNXGNWIY-UHFFFAOYSA-N. The full InChI is InChI=1S/ClO3.K.HNO2/c2-1(3)4;;2-1-3/h;;(H,2,3)/q-1;+1;.
What are the key properties of potassium;nitrous acid;chlorate?
potassium;nitrous acid;chlorate has a molecular weight of 169.56 g/mol, XLogP of -6.42, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;nitrous acid;chlorate is sourced from PubChem (CID 161014710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).