About 5-bromo-2,3-difluorobenzaldehyde;5-bromo-7-fluoro-1H-indazole
5-bromo-2,3-difluorobenzaldehyde;5-bromo-7-fluoro-1H-indazole (PubChem CID 161015055) has the molecular formula C14H7Br2F3N2O
and a molecular weight of 436.03 g/mol. Its IUPAC name is 5-bromo-2,3-difluorobenzaldehyde;5-bromo-7-fluoro-1H-indazole.
Molecular Properties
| Compound Name | 5-bromo-2,3-difluorobenzaldehyde;5-bromo-7-fluoro-1H-indazole |
| PubChem CID | 161015055 |
| Molecular Formula | C14H7Br2F3N2O |
| Molecular Weight | 436.03 g/mol |
| Exact Mass | 433.89 |
| IUPAC Name | 5-bromo-2,3-difluorobenzaldehyde;5-bromo-7-fluoro-1H-indazole |
| SMILES | Fc1cc(Br)cc2cn[nH]c12.O=Cc1cc(Br)cc(F)c1F |
| InChI | InChI=1S/C7H3BrF2O.C7H4BrFN2/c8-5-1-4(3-11)7(10)6(9)2-5;8-5-1-4-3-10-11-7(4)6(9)2-5/h1-3H;1-3H,(H,10,11) |
| InChIKey | TXPPMKFCOIZUJW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.03 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2,3-difluorobenzaldehyde;5-bromo-7-fluoro-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,3-difluorobenzaldehyde;5-bromo-7-fluoro-1H-indazole?
The IUPAC name of 5-bromo-2,3-difluorobenzaldehyde;5-bromo-7-fluoro-1H-indazole (CID 161015055) is 5-bromo-2,3-difluorobenzaldehyde;5-bromo-7-fluoro-1H-indazole.
What is the SMILES notation for 5-bromo-2,3-difluorobenzaldehyde;5-bromo-7-fluoro-1H-indazole?
The canonical SMILES for 5-bromo-2,3-difluorobenzaldehyde;5-bromo-7-fluoro-1H-indazole is Fc1cc(Br)cc2cn[nH]c12.O=Cc1cc(Br)cc(F)c1F.
What is the InChIKey of 5-bromo-2,3-difluorobenzaldehyde;5-bromo-7-fluoro-1H-indazole?
The InChIKey is TXPPMKFCOIZUJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3BrF2O.C7H4BrFN2/c8-5-1-4(3-11)7(10)6(9)2-5;8-5-1-4-3-10-11-7(4)6(9)2-5/h1-3H;1-3H,(H,10,11).
What are the key properties of 5-bromo-2,3-difluorobenzaldehyde;5-bromo-7-fluoro-1H-indazole?
5-bromo-2,3-difluorobenzaldehyde;5-bromo-7-fluoro-1H-indazole has a molecular weight of 436.03 g/mol, XLogP of 5.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,3-difluorobenzaldehyde;5-bromo-7-fluoro-1H-indazole is sourced from PubChem (CID 161015055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).