C23H20F3N5O2 — CID 161015471
2-amino-3-(difluoromethyl)-5-[4-(1-fluoroethoxy)-3-methylphenyl]-5-(3-pyrimidin-5-ylphenyl)imidazol-4-one (PubChem CID 161015471) has the molecular formula C23H20F3N5O2 and a molecular weight of 455.44 g/mol. Its IUPAC name is 2-amino-3-(difluoromethyl)-5-[4-(1-fluoroethoxy)-3-methylphenyl]-5-(3-pyrimidin-5-ylphenyl)imidazol-4-one.
| Compound Name | 2-amino-3-(difluoromethyl)-5-[4-(1-fluoroethoxy)-3-methylphenyl]-5-(3-pyrimidin-5-ylphenyl)imidazol-4-one |
|---|---|
| PubChem CID | 161015471 |
| Molecular Formula | C23H20F3N5O2 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 2-amino-3-(difluoromethyl)-5-[4-(1-fluoroethoxy)-3-methylphenyl]-5-(3-pyrimidin-5-ylphenyl)imidazol-4-one |
| SMILES | Cc1cc(C2(c3cccc(-c4cncnc4)c3)N=C(N)N(C(F)F)C2=O)ccc1OC(C)F |
| InChI | InChI=1S/C23H20F3N5O2/c1-13-8-18(6-7-19(13)33-14(2)24)23(20(32)31(21(25)26)22(27)30-23)17-5-3-4-15(9-17)16-10-28-12-29-11-16/h3-12,14,21H,1-2H3,(H2,27,30) |
| InChIKey | XBQGDBRLXYYXHE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|