C27H42N4O4 — CID 161015472
1-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrrole-2,5-dione;1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrole-2,5-dione (PubChem CID 161015472) has the molecular formula C27H42N4O4 and a molecular weight of 486.66 g/mol. Its IUPAC name is 1-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrrole-2,5-dione;1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrole-2,5-dione.
| Compound Name | 1-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrrole-2,5-dione;1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 161015472 |
| Molecular Formula | C27H42N4O4 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | 1-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrrole-2,5-dione;1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrole-2,5-dione |
| SMILES | CC1(C)CC(N2C(=O)C=CC2=O)CC(C)(C)N1.CN1C(C)(C)CC(N2C(=O)C=CC2=O)CC1(C)C |
| InChI | InChI=1S/C14H22N2O2.C13H20N2O2/c1-13(2)8-10(9-14(3,4)15(13)5)16-11(17)6-7-12(16)18;1-12(2)7-9(8-13(3,4)14-12)15-10(16)5-6-11(15)17/h6-7,10H,8-9H2,1-5H3;5-6,9,14H,7-8H2,1-4H3 |
| InChIKey | TXQYLVZLHPJDKQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|