C34H45Cl3N10O4 — CID 161015772
2-chloro-7-methyl-N-[2-(4-methylpiperazin-1-yl)ethyl]-3-nitroquinolin-4-amine;2,4-dichloro-7-methyl-3-nitroquinoline;2-(4-methylpiperazin-1-yl)ethanamine (PubChem CID 161015772) has the molecular formula C34H45Cl3N10O4 and a molecular weight of 764.16 g/mol. Its IUPAC name is 2-chloro-7-methyl-N-[2-(4-methylpiperazin-1-yl)ethyl]-3-nitroquinolin-4-amine;2,4-dichloro-7-methyl-3-nitroquinoline;2-(4-methylpiperazin-1-yl)ethanamine.
| Compound Name | 2-chloro-7-methyl-N-[2-(4-methylpiperazin-1-yl)ethyl]-3-nitroquinolin-4-amine;2,4-dichloro-7-methyl-3-nitroquinoline;2-(4-methylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 161015772 |
| Molecular Formula | C34H45Cl3N10O4 |
| Molecular Weight | 764.16 g/mol |
| Exact Mass | 762.27 |
| IUPAC Name | 2-chloro-7-methyl-N-[2-(4-methylpiperazin-1-yl)ethyl]-3-nitroquinolin-4-amine;2,4-dichloro-7-methyl-3-nitroquinoline;2-(4-methylpiperazin-1-yl)ethanamine |
| SMILES | CN1CCN(CCN)CC1.Cc1ccc2c(Cl)c([N+](=O)[O-])c(Cl)nc2c1.Cc1ccc2c(NCCN3CCN(C)CC3)c([N+](=O)[O-])c(Cl)nc2c1 |
| InChI | InChI=1S/C17H22ClN5O2.C10H6Cl2N2O2.C7H17N3/c1-12-3-4-13-14(11-12)20-17(18)16(23(24)25)15(13)19-5-6-22-9-7-21(2)8-10-22;1-5-2-3-6-7(4-5)13-10(12)9(8(6)11)14(15)16;1-9-4-6-10(3-2-8)7-5-9/h3-4,11H,5-10H2,1-2H3,(H,19,20);2-4H,1H3;2-8H2,1H3 |
| InChIKey | TXRYIUGRLUAJFL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 163.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.16 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|