2-methylpropanamide;sulfuric acid

C4H11NO5S — CID 161016252

IUPAC2-methylpropanamide;sulfuric acid
SMILESCC(C)C(N)=O.O=S(=O)(O)O
InChIInChI=1S/C4H9NO.H2O4S/c1-3(2)4(5)6;1-5(2,3)4/h3H,1-2H3,(H2,5,6);(H2,1,2,3,4)
InChIKeyTXTNXPQFHFTKHK-UHFFFAOYSA-N
MW185.20 g/mol
LogP-0.53
Rot. Bonds1

About 2-methylpropanamide;sulfuric acid

2-methylpropanamide;sulfuric acid (PubChem CID 161016252) has the molecular formula C4H11NO5S and a molecular weight of 185.20 g/mol. Its IUPAC name is 2-methylpropanamide;sulfuric acid.

Molecular Properties

Compound Name2-methylpropanamide;sulfuric acid
PubChem CID161016252
Molecular FormulaC4H11NO5S
Molecular Weight185.20 g/mol
Exact Mass185.04
IUPAC Name2-methylpropanamide;sulfuric acid
SMILESCC(C)C(N)=O.O=S(=O)(O)O
InChIInChI=1S/C4H9NO.H2O4S/c1-3(2)4(5)6;1-5(2,3)4/h3H,1-2H3,(H2,5,6);(H2,1,2,3,4)
InChIKeyTXTNXPQFHFTKHK-UHFFFAOYSA-N
XLogP-0.53
TPSA117.69 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.20
LogP ≤ 5-0.53
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-methylpropanamide;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylpropanamide;sulfuric acid?
The IUPAC name of 2-methylpropanamide;sulfuric acid (CID 161016252) is 2-methylpropanamide;sulfuric acid.
What is the SMILES notation for 2-methylpropanamide;sulfuric acid?
The canonical SMILES for 2-methylpropanamide;sulfuric acid is CC(C)C(N)=O.O=S(=O)(O)O.
What is the InChIKey of 2-methylpropanamide;sulfuric acid?
The InChIKey is TXTNXPQFHFTKHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.H2O4S/c1-3(2)4(5)6;1-5(2,3)4/h3H,1-2H3,(H2,5,6);(H2,1,2,3,4).
What are the key properties of 2-methylpropanamide;sulfuric acid?
2-methylpropanamide;sulfuric acid has a molecular weight of 185.20 g/mol, XLogP of -0.53, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanamide;sulfuric acid is sourced from PubChem (CID 161016252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).