About 2,2-difluoroindole;ethane
2,2-difluoroindole;ethane (PubChem CID 161017715) has the molecular formula C10H11F2N
and a molecular weight of 183.20 g/mol. Its IUPAC name is 2,2-difluoroindole;ethane.
Molecular Properties
| Compound Name | 2,2-difluoroindole;ethane |
| PubChem CID | 161017715 |
| Molecular Formula | C10H11F2N |
| Molecular Weight | 183.20 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 2,2-difluoroindole;ethane |
| SMILES | CC.FC1(F)C=c2ccccc2=N1 |
| InChI | InChI=1S/C8H5F2N.C2H6/c9-8(10)5-6-3-1-2-4-7(6)11-8;1-2/h1-5H;1-2H3 |
| InChIKey | TXYGBACZKCMUNV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoroindole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoroindole;ethane?
The IUPAC name of 2,2-difluoroindole;ethane (CID 161017715) is 2,2-difluoroindole;ethane.
What is the SMILES notation for 2,2-difluoroindole;ethane?
The canonical SMILES for 2,2-difluoroindole;ethane is CC.FC1(F)C=c2ccccc2=N1.
What is the InChIKey of 2,2-difluoroindole;ethane?
The InChIKey is TXYGBACZKCMUNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F2N.C2H6/c9-8(10)5-6-3-1-2-4-7(6)11-8;1-2/h1-5H;1-2H3.
What are the key properties of 2,2-difluoroindole;ethane?
2,2-difluoroindole;ethane has a molecular weight of 183.20 g/mol, XLogP of 1.72, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoroindole;ethane is sourced from PubChem (CID 161017715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).