C26H36O6 — CID 161019500
ethyl 5-(2-methoxyphenyl)pentanoate;5-(2-methoxyphenyl)pentanoic acid (PubChem CID 161019500) has the molecular formula C26H36O6 and a molecular weight of 444.57 g/mol. Its IUPAC name is ethyl 5-(2-methoxyphenyl)pentanoate;5-(2-methoxyphenyl)pentanoic acid.
| Compound Name | ethyl 5-(2-methoxyphenyl)pentanoate;5-(2-methoxyphenyl)pentanoic acid |
|---|---|
| PubChem CID | 161019500 |
| Molecular Formula | C26H36O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | ethyl 5-(2-methoxyphenyl)pentanoate;5-(2-methoxyphenyl)pentanoic acid |
| SMILES | CCOC(=O)CCCCc1ccccc1OC.COc1ccccc1CCCCC(=O)O |
| InChI | InChI=1S/C14H20O3.C12H16O3/c1-3-17-14(15)11-7-5-9-12-8-4-6-10-13(12)16-2;1-15-11-8-4-2-6-10(11)7-3-5-9-12(13)14/h4,6,8,10H,3,5,7,9,11H2,1-2H3;2,4,6,8H,3,5,7,9H2,1H3,(H,13,14) |
| InChIKey | TYEGFGAVYLWYFG-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|