C40H43ClN12O5 — CID 161019563
ethyl 4-[[1-[2-[(3S,5R)-4-acetyl-3,5-dimethylpiperazin-1-yl]-4-pyridinyl]-1,2,4-triazol-3-yl]amino]benzoate;ethyl 4-[[1-(2-chloro-4-pyridinyl)-1,2,4-triazol-3-yl]amino]benzoate (PubChem CID 161019563) has the molecular formula C40H43ClN12O5 and a molecular weight of 807.32 g/mol. Its IUPAC name is ethyl 4-[[1-[2-[(3S,5R)-4-acetyl-3,5-dimethylpiperazin-1-yl]-4-pyridinyl]-1,2,4-triazol-3-yl]amino]benzoate;ethyl 4-[[1-(2-chloro-4-pyridinyl)-1,2,4-triazol-3-yl]amino]benzoate.
| Compound Name | ethyl 4-[[1-[2-[(3S,5R)-4-acetyl-3,5-dimethylpiperazin-1-yl]-4-pyridinyl]-1,2,4-triazol-3-yl]amino]benzoate;ethyl 4-[[1-(2-chloro-4-pyridinyl)-1,2,4-triazol-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 161019563 |
| Molecular Formula | C40H43ClN12O5 |
| Molecular Weight | 807.32 g/mol |
| Exact Mass | 806.32 |
| IUPAC Name | ethyl 4-[[1-[2-[(3S,5R)-4-acetyl-3,5-dimethylpiperazin-1-yl]-4-pyridinyl]-1,2,4-triazol-3-yl]amino]benzoate;ethyl 4-[[1-(2-chloro-4-pyridinyl)-1,2,4-triazol-3-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2ncn(-c3ccnc(Cl)c3)n2)cc1.CCOC(=O)c1ccc(Nc2ncn(-c3ccnc(N4C[C@@H](C)N(C(C)=O)[C@@H](C)C4)c3)n2)cc1 |
| InChI | InChI=1S/C24H29N7O3.C16H14ClN5O2/c1-5-34-23(33)19-6-8-20(9-7-19)27-24-26-15-30(28-24)21-10-11-25-22(12-21)29-13-16(2)31(18(4)32)17(3)14-29;1-2-24-15(23)11-3-5-12(6-4-11)20-16-19-10-22(21-16)13-7-8-18-14(17)9-13/h6-12,15-17H,5,13-14H2,1-4H3,(H,27,28);3-10H,2H2,1H3,(H,20,21)/t16-,17+; |
| InChIKey | TYELOWMHPMHMFE-OKZTUQRJSA-N |
| XLogP | 6.26 |
| TPSA | 187.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.32 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|