About 2,4-dimethylbenzaldehyde;2-hydroxy-4-methylbenzaldehyde;methane
2,4-dimethylbenzaldehyde;2-hydroxy-4-methylbenzaldehyde;methane (PubChem CID 161019797) has the molecular formula C20H30O3
and a molecular weight of 318.46 g/mol. Its IUPAC name is 2,4-dimethylbenzaldehyde;2-hydroxy-4-methylbenzaldehyde;methane.
Molecular Properties
| Compound Name | 2,4-dimethylbenzaldehyde;2-hydroxy-4-methylbenzaldehyde;methane |
| PubChem CID | 161019797 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 2,4-dimethylbenzaldehyde;2-hydroxy-4-methylbenzaldehyde;methane |
| SMILES | C.C.C.Cc1ccc(C=O)c(C)c1.Cc1ccc(C=O)c(O)c1 |
| InChI | InChI=1S/C9H10O.C8H8O2.3CH4/c1-7-3-4-9(6-10)8(2)5-7;1-6-2-3-7(5-9)8(10)4-6;;;/h3-6H,1-2H3;2-5,10H,1H3;3*1H4 |
| InChIKey | TYFDUQGKXAMZPJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethylbenzaldehyde;2-hydroxy-4-methylbenzaldehyde;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylbenzaldehyde;2-hydroxy-4-methylbenzaldehyde;methane?
The IUPAC name of 2,4-dimethylbenzaldehyde;2-hydroxy-4-methylbenzaldehyde;methane (CID 161019797) is 2,4-dimethylbenzaldehyde;2-hydroxy-4-methylbenzaldehyde;methane.
What is the SMILES notation for 2,4-dimethylbenzaldehyde;2-hydroxy-4-methylbenzaldehyde;methane?
The canonical SMILES for 2,4-dimethylbenzaldehyde;2-hydroxy-4-methylbenzaldehyde;methane is C.C.C.Cc1ccc(C=O)c(C)c1.Cc1ccc(C=O)c(O)c1.
What is the InChIKey of 2,4-dimethylbenzaldehyde;2-hydroxy-4-methylbenzaldehyde;methane?
The InChIKey is TYFDUQGKXAMZPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.C8H8O2.3CH4/c1-7-3-4-9(6-10)8(2)5-7;1-6-2-3-7(5-9)8(10)4-6;;;/h3-6H,1-2H3;2-5,10H,1H3;3*1H4.
What are the key properties of 2,4-dimethylbenzaldehyde;2-hydroxy-4-methylbenzaldehyde;methane?
2,4-dimethylbenzaldehyde;2-hydroxy-4-methylbenzaldehyde;methane has a molecular weight of 318.46 g/mol, XLogP of 5.54, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylbenzaldehyde;2-hydroxy-4-methylbenzaldehyde;methane is sourced from PubChem (CID 161019797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).