About 2-[2-(4-methylbenzene-6-id-1-yl)prop-2-enyl]propane-1,3-diol;bis(yttrium)
2-[2-(4-methylbenzene-6-id-1-yl)prop-2-enyl]propane-1,3-diol;bis(yttrium) (PubChem CID 161019858) has the molecular formula C13H17O2Y2-
and a molecular weight of 383.09 g/mol. Its IUPAC name is 2-[2-(4-methylbenzene-6-id-1-yl)prop-2-enyl]propane-1,3-diol;bis(yttrium).
Molecular Properties
| Compound Name | 2-[2-(4-methylbenzene-6-id-1-yl)prop-2-enyl]propane-1,3-diol;bis(yttrium) |
| PubChem CID | 161019858 |
| Molecular Formula | C13H17O2Y2- |
| Molecular Weight | 383.09 g/mol |
| Exact Mass | 382.94 |
| IUPAC Name | 2-[2-(4-methylbenzene-6-id-1-yl)prop-2-enyl]propane-1,3-diol;bis(yttrium) |
| SMILES | C=C(CC(CO)CO)c1[c-]cc(C)cc1.[Y].[Y] |
| InChI | InChI=1S/C13H17O2.2Y/c1-10-3-5-13(6-4-10)11(2)7-12(8-14)9-15;;/h3-5,12,14-15H,2,7-9H2,1H3;;/q-1;; |
| InChIKey | JJHRPOSDDHDFGF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.09 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(4-methylbenzene-6-id-1-yl)prop-2-enyl]propane-1,3-diol;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-methylbenzene-6-id-1-yl)prop-2-enyl]propane-1,3-diol;bis(yttrium)?
The IUPAC name of 2-[2-(4-methylbenzene-6-id-1-yl)prop-2-enyl]propane-1,3-diol;bis(yttrium) (CID 161019858) is 2-[2-(4-methylbenzene-6-id-1-yl)prop-2-enyl]propane-1,3-diol;bis(yttrium).
What is the SMILES notation for 2-[2-(4-methylbenzene-6-id-1-yl)prop-2-enyl]propane-1,3-diol;bis(yttrium)?
The canonical SMILES for 2-[2-(4-methylbenzene-6-id-1-yl)prop-2-enyl]propane-1,3-diol;bis(yttrium) is C=C(CC(CO)CO)c1[c-]cc(C)cc1.[Y].[Y].
What is the InChIKey of 2-[2-(4-methylbenzene-6-id-1-yl)prop-2-enyl]propane-1,3-diol;bis(yttrium)?
The InChIKey is JJHRPOSDDHDFGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17O2.2Y/c1-10-3-5-13(6-4-10)11(2)7-12(8-14)9-15;;/h3-5,12,14-15H,2,7-9H2,1H3;;/q-1;;.
What are the key properties of 2-[2-(4-methylbenzene-6-id-1-yl)prop-2-enyl]propane-1,3-diol;bis(yttrium)?
2-[2-(4-methylbenzene-6-id-1-yl)prop-2-enyl]propane-1,3-diol;bis(yttrium) has a molecular weight of 383.09 g/mol, XLogP of 1.79, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-methylbenzene-6-id-1-yl)prop-2-enyl]propane-1,3-diol;bis(yttrium) is sourced from PubChem (CID 161019858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).