C23H38O8 — CID 161020063
ethyl 3-[(2S,4R)-6-[[(2S,3R,4R,4aS,6R,7R,8aS)-3,7-dihydroxy-6-(hydroxymethyl)-4-methyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]propanoate (PubChem CID 161020063) has the molecular formula C23H38O8 and a molecular weight of 442.55 g/mol. Its IUPAC name is ethyl 3-[(2S,4R)-6-[[(2S,3R,4R,4aS,6R,7R,8aS)-3,7-dihydroxy-6-(hydroxymethyl)-4-methyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]propanoate.
| Compound Name | ethyl 3-[(2S,4R)-6-[[(2S,3R,4R,4aS,6R,7R,8aS)-3,7-dihydroxy-6-(hydroxymethyl)-4-methyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]propanoate |
|---|---|
| PubChem CID | 161020063 |
| Molecular Formula | C23H38O8 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | ethyl 3-[(2S,4R)-6-[[(2S,3R,4R,4aS,6R,7R,8aS)-3,7-dihydroxy-6-(hydroxymethyl)-4-methyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]propanoate |
| SMILES | C=C1C(C[C@@H]2O[C@H]3C[C@@H](O)[C@@H](CO)O[C@H]3[C@H](C)[C@H]2O)O[C@@H](CCC(=O)OCC)C[C@H]1C |
| InChI | InChI=1S/C23H38O8/c1-5-28-21(26)7-6-15-8-12(2)13(3)17(29-15)10-18-22(27)14(4)23-19(30-18)9-16(25)20(11-24)31-23/h12,14-20,22-25,27H,3,5-11H2,1-2,4H3/t12-,14-,15+,16-,17?,18+,19+,20-,22-,23+/m1/s1 |
| InChIKey | LXFRZORLOIFUOR-HEHXRLFRSA-N |
| XLogP | 1.34 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|