About 2-hydroxypropyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate
2-hydroxypropyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate (PubChem CID 161020917) has the molecular formula C12H20O5
and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-hydroxypropyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 2-hydroxypropyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate |
| PubChem CID | 161020917 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2-hydroxypropyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=C(C)C(=O)OCC(C)O |
| InChI | InChI=1S/C7H12O3.C5H8O2/c1-5(2)7(9)10-4-6(3)8;1-4(2)5(6)7-3/h6,8H,1,4H2,2-3H3;1H2,2-3H3 |
| InChIKey | TYIXEUDEYXVHQX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate?
The IUPAC name of 2-hydroxypropyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate (CID 161020917) is 2-hydroxypropyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate.
What is the SMILES notation for 2-hydroxypropyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate?
The canonical SMILES for 2-hydroxypropyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate is C=C(C)C(=O)OC.C=C(C)C(=O)OCC(C)O.
What is the InChIKey of 2-hydroxypropyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate?
The InChIKey is TYIXEUDEYXVHQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3.C5H8O2/c1-5(2)7(9)10-4-6(3)8;1-4(2)5(6)7-3/h6,8H,1,4H2,2-3H3;1H2,2-3H3.
What are the key properties of 2-hydroxypropyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate?
2-hydroxypropyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate has a molecular weight of 244.29 g/mol, XLogP of 1.22, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate is sourced from PubChem (CID 161020917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).