C53H44F3N3 — CID 161021692
3-tert-butyl-9-[2-[5-(3-tert-butylcarbazol-9-yl)-2-isocyanophenyl]-4-[2-methyl-4-(trifluoromethyl)phenyl]phenyl]carbazole (PubChem CID 161021692) has the molecular formula C53H44F3N3 and a molecular weight of 779.95 g/mol. Its IUPAC name is 3-tert-butyl-9-[2-[5-(3-tert-butylcarbazol-9-yl)-2-isocyanophenyl]-4-[2-methyl-4-(trifluoromethyl)phenyl]phenyl]carbazole.
| Compound Name | 3-tert-butyl-9-[2-[5-(3-tert-butylcarbazol-9-yl)-2-isocyanophenyl]-4-[2-methyl-4-(trifluoromethyl)phenyl]phenyl]carbazole |
|---|---|
| PubChem CID | 161021692 |
| Molecular Formula | C53H44F3N3 |
| Molecular Weight | 779.95 g/mol |
| Exact Mass | 779.35 |
| IUPAC Name | 3-tert-butyl-9-[2-[5-(3-tert-butylcarbazol-9-yl)-2-isocyanophenyl]-4-[2-methyl-4-(trifluoromethyl)phenyl]phenyl]carbazole |
| SMILES | [C-]#[N+]c1ccc(-n2c3ccccc3c3cc(C(C)(C)C)ccc32)cc1-c1cc(-c2ccc(C(F)(F)F)cc2C)ccc1-n1c2ccccc2c2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C53H44F3N3/c1-32-27-36(53(54,55)56)18-22-38(32)33-17-24-49(59-47-16-12-10-14-40(47)44-30-35(52(5,6)7)20-26-50(44)59)42(28-33)41-31-37(21-23-45(41)57-8)58-46-15-11-9-13-39(46)43-29-34(51(2,3)4)19-25-48(43)58/h9-31H,1-7H3 |
| InChIKey | XTPPHSWYBRQXGU-UHFFFAOYSA-N |
| XLogP | 15.69 |
| TPSA | 14.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.95 |
| LogP ≤ 5 | 15.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|