About bis(carbon dioxide);N-[3-ethyl-1-[4-[4-(5-methylfuran-2-yl)phenoxy]phenyl]pentan-3-yl]acetamide
bis(carbon dioxide);N-[3-ethyl-1-[4-[4-(5-methylfuran-2-yl)phenoxy]phenyl]pentan-3-yl]acetamide (PubChem CID 161022054) has the molecular formula C28H31NO7
and a molecular weight of 493.56 g/mol. Its IUPAC name is bis(carbon dioxide);N-[3-ethyl-1-[4-[4-(5-methylfuran-2-yl)phenoxy]phenyl]pentan-3-yl]acetamide.
Molecular Properties
| Compound Name | bis(carbon dioxide);N-[3-ethyl-1-[4-[4-(5-methylfuran-2-yl)phenoxy]phenyl]pentan-3-yl]acetamide |
| PubChem CID | 161022054 |
| Molecular Formula | C28H31NO7 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | bis(carbon dioxide);N-[3-ethyl-1-[4-[4-(5-methylfuran-2-yl)phenoxy]phenyl]pentan-3-yl]acetamide |
| SMILES | CCC(CC)(CCc1ccc(Oc2ccc(-c3ccc(C)o3)cc2)cc1)NC(C)=O.O=C=O.O=C=O |
| InChI | InChI=1S/C26H31NO3.2CO2/c1-5-26(6-2,27-20(4)28)18-17-21-8-12-23(13-9-21)30-24-14-10-22(11-15-24)25-16-7-19(3)29-25;2*2-1-3/h7-16H,5-6,17-18H2,1-4H3,(H,27,28);; |
| InChIKey | TYMTVHYGQAJOLS-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze bis(carbon dioxide);N-[3-ethyl-1-[4-[4-(5-methylfuran-2-yl)phenoxy]phenyl]pentan-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(carbon dioxide);N-[3-ethyl-1-[4-[4-(5-methylfuran-2-yl)phenoxy]phenyl]pentan-3-yl]acetamide?
The IUPAC name of bis(carbon dioxide);N-[3-ethyl-1-[4-[4-(5-methylfuran-2-yl)phenoxy]phenyl]pentan-3-yl]acetamide (CID 161022054) is bis(carbon dioxide);N-[3-ethyl-1-[4-[4-(5-methylfuran-2-yl)phenoxy]phenyl]pentan-3-yl]acetamide.
What is the SMILES notation for bis(carbon dioxide);N-[3-ethyl-1-[4-[4-(5-methylfuran-2-yl)phenoxy]phenyl]pentan-3-yl]acetamide?
The canonical SMILES for bis(carbon dioxide);N-[3-ethyl-1-[4-[4-(5-methylfuran-2-yl)phenoxy]phenyl]pentan-3-yl]acetamide is CCC(CC)(CCc1ccc(Oc2ccc(-c3ccc(C)o3)cc2)cc1)NC(C)=O.O=C=O.O=C=O.
What is the InChIKey of bis(carbon dioxide);N-[3-ethyl-1-[4-[4-(5-methylfuran-2-yl)phenoxy]phenyl]pentan-3-yl]acetamide?
The InChIKey is TYMTVHYGQAJOLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31NO3.2CO2/c1-5-26(6-2,27-20(4)28)18-17-21-8-12-23(13-9-21)30-24-14-10-22(11-15-24)25-16-7-19(3)29-25;2*2-1-3/h7-16H,5-6,17-18H2,1-4H3,(H,27,28);;.
What are the key properties of bis(carbon dioxide);N-[3-ethyl-1-[4-[4-(5-methylfuran-2-yl)phenoxy]phenyl]pentan-3-yl]acetamide?
bis(carbon dioxide);N-[3-ethyl-1-[4-[4-(5-methylfuran-2-yl)phenoxy]phenyl]pentan-3-yl]acetamide has a molecular weight of 493.56 g/mol, XLogP of 5.51, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(carbon dioxide);N-[3-ethyl-1-[4-[4-(5-methylfuran-2-yl)phenoxy]phenyl]pentan-3-yl]acetamide is sourced from PubChem (CID 161022054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).